cas: 1214387-06-0 — see every product listed under this CAS number, including other names
Ethyl 4,5-Difluoro-2-nitrobenzoate 95% (CAS 1214387-06-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A831670-1g |
| cas | 1214387-06-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 136.75 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 10g | 325.88 Pln | |
| Ambeed | 25g | 681.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A831670 |
Ethyl 4,5-difluoro-2-nitrobenzoate (CAS 1214387-06-0) is a chemical compound with the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. IUPAC name: ethyl 4,5-difluoro-2-nitrobenzoate. InChIKey: CWBDZGOBRZAYMQ-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO4 |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | ethyl 4,5-difluoro-2-nitrobenzoate |
| InChIKey | CWBDZGOBRZAYMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)