Ethyl 4,5-difluoro-2-nitrobenzoate, 95%
cas: 1214387-06-0 — see every product listed under this CAS number, including other names
Ethyl 4,5-difluoro-2-nitrobenzoate, 95% (CAS 1214387-06-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g, 25g, 100mg, 250mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | ST-8103-5g |
| cas | 1214387-06-0 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 5g | 211.40 Pln | |
| Fluorochem | 10g | 305.12 Pln | |
| Fluorochem | 25g | 643.54 Pln | |
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 303.62 Pln | |
| Ambeed | 25g | 626.25 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 10g | 357.20 Pln | |
| Chemat | 25g | 693.20 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 231.05 Pln | |
| BLDpharm | 10g | 319.91 Pln | |
| BLDpharm | 25g | 669.79 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Ethyl 4,5-difluoro-2-nitrobenzoate (CAS 1214387-06-0) is a chemical compound with the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. IUPAC name: ethyl 4,5-difluoro-2-nitrobenzoate. InChIKey: CWBDZGOBRZAYMQ-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO4 |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | ethyl 4,5-difluoro-2-nitrobenzoate |
| InChIKey | CWBDZGOBRZAYMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1[N+](=O)[O-])F)F |
Computed by PubChem (NCBI)