CAS 179011-37-1 appears in our catalog under these names: Ethyl 2,4-difluoro-5-nitrobenzoate, 98%, Ethyl 2,4-difluoro-5-nitrobenzoate, 97%, 97%, 2,4-Difluoro-5-nitro-benzoic acid ethyl ester, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
Ethyl 2,4-difluoro-5-nitrobenzoate (CAS 179011-37-1) is a chemical compound with the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. IUPAC name: ethyl 2,4-difluoro-5-nitrobenzoate. InChIKey: HKGIEPXOWGJFCW-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO4 |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | ethyl 2,4-difluoro-5-nitrobenzoate |
| InChIKey | HKGIEPXOWGJFCW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)