cas: 76360-82-2 — see every product listed under this CAS number, including other names
Ethyl 4-(methylamino)-2-(methylsulfanyl)-5-pyrimidinecarboxylate 97% (CAS 76360-82-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A466017-250mg |
| cas | 76360-82-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 398.19 Pln | |
| Ambeed | 25g | 1660.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A466017 |
Ethyl 4-(methylamino)-2-methylsulfanylpyrimidine-5-carboxylate (CAS 76360-82-2) is a chemical compound with the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. IUPAC name: ethyl 4-(methylamino)-2-methylsulfanylpyrimidine-5-carboxylate. InChIKey: VDDZMXQAZJMGPK-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | ethyl 4-(methylamino)-2-methylsulfanylpyrimidine-5-carboxylate |
| InChIKey | VDDZMXQAZJMGPK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1NC)SC |
Computed by PubChem (NCBI)