cas: 76360-82-2 — see every product listed under this CAS number, including other names
Ethyl 4-(methylamino)-2-(methylsulfanyl)-5-pyrimidinecarboxylate, 97%, 97% (CAS 76360-82-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114Q08-100mg |
| cas | 76360-82-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 294.80 Pln | |
| Chemat | 10g | 486.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-(methylamino)-2-methylsulfanylpyrimidine-5-carboxylate (CAS 76360-82-2) is a chemical compound with the molecular formula C9H13N3O2S and a molecular weight of 227.29 g/mol. IUPAC name: ethyl 4-(methylamino)-2-methylsulfanylpyrimidine-5-carboxylate. InChIKey: VDDZMXQAZJMGPK-UHFFFAOYSA-N.
| Molecular formula | C9H13N3O2S |
|---|---|
| Molecular weight | 227.29 g/mol |
| IUPAC name | ethyl 4-(methylamino)-2-methylsulfanylpyrimidine-5-carboxylate |
| InChIKey | VDDZMXQAZJMGPK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(N=C1NC)SC |
Computed by PubChem (NCBI)