cas: 51934-43-1 — see every product listed under this CAS number, including other names
Ethyl 4-Bromo-1-naphthoate, 95%, 95% (CAS 51934-43-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0AL-100mg |
| cas | 51934-43-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 722.00 Pln | |
| Chemat | 5g | 1725.20 Pln | |
| Chemat | 10g | 2574.80 Pln | |
| Chemat | 25g | 4619.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-bromonaphthalene-1-carboxylate (CAS 51934-43-1) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: ethyl 4-bromonaphthalene-1-carboxylate. InChIKey: OZDVHZHNLGGADD-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | ethyl 4-bromonaphthalene-1-carboxylate |
| InChIKey | OZDVHZHNLGGADD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C2=CC=CC=C21)Br |
Computed by PubChem (NCBI)