Ethyl 4-amino-2-(trifluoromethyl)benzoate 97%
cas: 1171245-63-8 — see every product listed under this CAS number, including other names
Ethyl 4-amino-2-(trifluoromethyl)benzoate 97% (CAS 1171245-63-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A188280-100mg |
| cas | 1171245-63-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 147.88 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 25g | 1366.06 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A188280 |
Ethyl 4-amino-2-(trifluoromethyl)benzoate (CAS 1171245-63-8) is a chemical compound with the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. IUPAC name: ethyl 4-amino-2-(trifluoromethyl)benzoate. InChIKey: WJUSTBDZBSDNOJ-UHFFFAOYSA-N.
| Molecular formula | C10H10F3NO2 |
|---|---|
| Molecular weight | 233.19 g/mol |
| IUPAC name | ethyl 4-amino-2-(trifluoromethyl)benzoate |
| InChIKey | WJUSTBDZBSDNOJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)