cas: 1273577-20-0 — see every product listed under this CAS number, including other names
Ethyl 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate, 97%, 97% (CAS 1273577-20-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111WYF-100mg |
| cas | 1273577-20-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 386.00 Pln | |
| Chemat | 500mg | 621.20 Pln | |
| Chemat | 1g | 990.80 Pln | |
| Chemat | 5g | 2848.40 Pln | |
| Chemat | 10g | 4797.20 Pln | |
| Chemat | 25g | 9530.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate (CAS 1273577-20-0) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: ethyl 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate. InChIKey: KLUYWIPXVPAABV-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | ethyl 4-chloro-1H-pyrrolo[2,3-b]pyridine-3-carboxylate |
| InChIKey | KLUYWIPXVPAABV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=NC=CC(=C12)Cl |
Computed by PubChem (NCBI)