cas: 338954-49-7 — see every product listed under this CAS number, including other names
Ethyl 4-chloro-5,7-dimethylquinoline-3-carboxylate, 97%, 97% (CAS 338954-49-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QA5-100mg |
| cas | 338954-49-7 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 717.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 4-chloro-5,7-dimethylquinoline-3-carboxylate (CAS 338954-49-7) is a chemical compound with the molecular formula C14H14ClNO2 and a molecular weight of 263.72 g/mol. IUPAC name: ethyl 4-chloro-5,7-dimethylquinoline-3-carboxylate. InChIKey: VTIBBHSQWPMQAQ-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO2 |
|---|---|
| Molecular weight | 263.72 g/mol |
| IUPAC name | ethyl 4-chloro-5,7-dimethylquinoline-3-carboxylate |
| InChIKey | VTIBBHSQWPMQAQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(C=C(C=C2N=C1)C)C)Cl |
Computed by PubChem (NCBI)