cas: 55613-22-4 — see every product listed under this CAS number, including other names
Ethyl 4-hydroxy-2-phenylpyrimidine-5-carboxylate, 98%, 98% (CAS 55613-22-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D986-250mg |
| cas | 55613-22-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 606.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 6-oxo-2-phenyl-1H-pyrimidine-5-carboxylate (CAS 55613-22-4) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: ethyl 6-oxo-2-phenyl-1H-pyrimidine-5-carboxylate. InChIKey: JSIHCFJCICVJHJ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | ethyl 6-oxo-2-phenyl-1H-pyrimidine-5-carboxylate |
| InChIKey | JSIHCFJCICVJHJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(NC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)