CAS 284462-58-4 appears in our catalog under these names: 5-(4-Aminophenoxy)nicotinic acid methyl ester, 98%, 5-(4-Aminophenoxy)nicotinic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
Methyl 5-(4-aminophenoxy)pyridine-3-carboxylate (CAS 284462-58-4) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: methyl 5-(4-aminophenoxy)pyridine-3-carboxylate. InChIKey: SPPJUUNCUKYHSS-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | methyl 5-(4-aminophenoxy)pyridine-3-carboxylate |
| InChIKey | SPPJUUNCUKYHSS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN=C1)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)