CAS 1202863-03-3 is the registry number for 5-Benzyloxy-2-nitroaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-nitro-5-phenylmethoxyaniline (CAS 1202863-03-3) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 2-nitro-5-phenylmethoxyaniline. InChIKey: WBSSIOAVAMIQPP-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 2-nitro-5-phenylmethoxyaniline |
| InChIKey | WBSSIOAVAMIQPP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)[N+](=O)[O-])N |
Computed by PubChem (NCBI)