CAS 423753-42-8 appears in our catalog under these names: 2,5-Dimethyl-1-(3-nitrophenyl)-1h-pyrrole-3-carbaldehyde, 95%, 2,5-Dimethyl-1-(3-nitrophenyl)-1h-pyrrole-3-carbaldehyde, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
2,5-dimethyl-1-(3-nitrophenyl)pyrrole-3-carbaldehyde (CAS 423753-42-8) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 2,5-dimethyl-1-(3-nitrophenyl)pyrrole-3-carbaldehyde. InChIKey: VPEWMYSPADRRBT-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 2,5-dimethyl-1-(3-nitrophenyl)pyrrole-3-carbaldehyde |
| InChIKey | VPEWMYSPADRRBT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC(=CC=C2)[N+](=O)[O-])C)C=O |
Computed by PubChem (NCBI)