CAS 956438-21-4 appears in our catalog under these names: (3,5-Dimethyl-1-phenyl-1h-pyrazol-4-yl)(oxo)acetic acid, 95%, 2-(3,5-Dimethyl-1-phenyl-1H-pyrazol-4-yl)-2-oxoacetic acid, 95%, 3,5-Dimethyl-1-phenyl-1H-pyrazole 4-Oxoacetic Acid, 2-(3,5-Dimethyl-1-phenyl-1H-pyrazol-4-yl)-2-oxoacetic acid. Offered by: Combi-blocks, AmBeed, TRC, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 2,5g.
2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetic acid (CAS 956438-21-4) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetic acid. InChIKey: SDHVYDRRHVZGNT-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | 2-(3,5-dimethyl-1-phenylpyrazol-4-yl)-2-oxoacetic acid |
| InChIKey | SDHVYDRRHVZGNT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)C(=O)C(=O)O |
Computed by PubChem (NCBI)