CAS 757251-59-5 appears in our catalog under these names: Methyl 4-(4-aminophenoxy)pyridine-2-carboxylate, 95%, Methyl 4-(4-aminophenoxy)pyridine-2-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
Methyl 4-(4-aminophenoxy)pyridine-2-carboxylate (CAS 757251-59-5) is a chemical compound with the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. IUPAC name: methyl 4-(4-aminophenoxy)pyridine-2-carboxylate. InChIKey: LKNOOBDGFHXDIE-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3 |
|---|---|
| Molecular weight | 244.25 g/mol |
| IUPAC name | methyl 4-(4-aminophenoxy)pyridine-2-carboxylate |
| InChIKey | LKNOOBDGFHXDIE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)