cas: 82754-70-9 — see every product listed under this CAS number, including other names
Ethyl 5-amino-3-(2-ethoxy-2-oxoethyl)isoxazole-4-carboxylate 97% (CAS 82754-70-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A248619-100mg |
| cas | 82754-70-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 592.88 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 2600.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A248619 |
Ethyl 5-amino-3-(2-ethoxy-2-oxoethyl)-1,2-oxazole-4-carboxylate (CAS 82754-70-9) is a chemical compound with the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. IUPAC name: ethyl 5-amino-3-(2-ethoxy-2-oxoethyl)-1,2-oxazole-4-carboxylate. InChIKey: SNSXFXIUJVDZID-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O5 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | ethyl 5-amino-3-(2-ethoxy-2-oxoethyl)-1,2-oxazole-4-carboxylate |
| InChIKey | SNSXFXIUJVDZID-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=NOC(=C1C(=O)OCC)N |
Computed by PubChem (NCBI)