cas: 1110727-49-5 — see every product listed under this CAS number, including other names
Ethyl 5-nitro-2,3-dihydrobenzofuran-2-carboxylate, 97% (CAS 1110727-49-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F545175-250MG |
| cas | 1110727-49-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 914.28 Pln | |
| Fluorochem | 1g | 2169.05 Pln | |
| Fluorochem | 5g | 6375.90 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-nitro-2,3-dihydro-1-benzofuran-2-carboxylate (CAS 1110727-49-5) is a chemical compound with the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. IUPAC name: ethyl 5-nitro-2,3-dihydro-1-benzofuran-2-carboxylate. InChIKey: WAALXFOGNROGJV-UHFFFAOYSA-N.
| Molecular formula | C11H11NO5 |
|---|---|
| Molecular weight | 237.21 g/mol |
| IUPAC name | ethyl 5-nitro-2,3-dihydro-1-benzofuran-2-carboxylate |
| InChIKey | WAALXFOGNROGJV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)