cas: 30563-98-5 — see every product listed under this CAS number, including other names
Ethyl 5-nitropicolinate, 97% (CAS 30563-98-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A192646-25g |
| cas | 30563-98-5 |
| size | 25g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 8064.28 Pln | |
| AmBeed | 10g | 3878.35 Pln | |
| AmBeed | 250mg | 271.81 Pln | |
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 289.50 Pln | |
| Fluorochem | 5g | 987.17 Pln | |
| Fluorochem | 10g | 1924.34 Pln | |
| Fluorochem | 25g | 4730.64 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 5-nitropyridine-2-carboxylate (CAS 30563-98-5) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: ethyl 5-nitropyridine-2-carboxylate. InChIKey: PZFHVUFNOKRFEC-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | ethyl 5-nitropyridine-2-carboxylate |
| InChIKey | PZFHVUFNOKRFEC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)