cas: 64119-42-2 — see every product listed under this CAS number, including other names
Ethyl 6-Chloro-5-cyano-2-methylnicotinate, 95%, 95% (CAS 64119-42-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ELWS-10g |
| cas | 64119-42-2 |
| size | 10g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 1379.60 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 184.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Ethyl 6-chloro-5-cyano-2-methylpyridine-3-carboxylate (CAS 64119-42-2) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: ethyl 6-chloro-5-cyano-2-methylpyridine-3-carboxylate. InChIKey: QXZBVLFURRXJLB-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | ethyl 6-chloro-5-cyano-2-methylpyridine-3-carboxylate |
| InChIKey | QXZBVLFURRXJLB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C(=C1)C#N)Cl)C |
Computed by PubChem (NCBI)