Ethyl 6-chloro-4-(trifluoromethyl)picolinate, 98%
cas: 939047-74-2 — see every product listed under this CAS number, including other names
Ethyl 6-chloro-4-(trifluoromethyl)picolinate, 98% (CAS 939047-74-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1708281-50mg |
| cas | 939047-74-2 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 631.81 Pln | |
| Ambeed | 100mg | 1021.19 Pln | |
| Ambeed | 250mg | 1688.69 Pln | |
| Ambeed | 1g | 4425.44 Pln | |
| BLDpharm | 50mg | 675.34 Pln | |
| BLDpharm | 100mg | 1097.42 Pln | |
| BLDpharm | 250mg | 1813.83 Pln | |
| BLDpharm | 1g | 4768.35 Pln | |
| Chemat | 50mg | 726.80 Pln | |
| Chemat | 100mg | 1192.40 Pln | |
| Chemat | 250mg | 1979.60 Pln | |
| Chemat | 1g | 5234.00 Pln | |
| Fluorochem | 100mg | 2210.70 Pln | |
| Fluorochem | 250mg | 3663.31 Pln | |
| Fluorochem | 1g | 9541.45 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 6-chloro-4-(trifluoromethyl)pyridine-2-carboxylate (CAS 939047-74-2) is a chemical compound with the molecular formula C9H7ClF3NO2 and a molecular weight of 253.60 g/mol. IUPAC name: ethyl 6-chloro-4-(trifluoromethyl)pyridine-2-carboxylate. InChIKey: APQUVHSAFUZWJZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO2 |
|---|---|
| Molecular weight | 253.60 g/mol |
| IUPAC name | ethyl 6-chloro-4-(trifluoromethyl)pyridine-2-carboxylate |
| InChIKey | APQUVHSAFUZWJZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CC(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)