Products 939047-74-2
CAS 939047-74-2 is the registry number for Ethyl 6-chloro-4-(trifluoromethyl)picolinate, 98%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g.
Ethyl 6-chloro-4-(trifluoromethyl)pyridine-2-carboxylate (CAS 939047-74-2) is a chemical compound with the molecular formula C9H7ClF3NO2 and a molecular weight of 253.60 g/mol. IUPAC name: ethyl 6-chloro-4-(trifluoromethyl)pyridine-2-carboxylate. InChIKey: APQUVHSAFUZWJZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClF3NO2 |
|---|---|
| Molecular weight | 253.60 g/mol |
| IUPAC name | ethyl 6-chloro-4-(trifluoromethyl)pyridine-2-carboxylate |
| InChIKey | APQUVHSAFUZWJZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=CC(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)