cas: 142547-15-7 — see every product listed under this CAS number, including other names
Ethyl cis-2-amino-1-cyclopentane carboxylate hydrochloride, 99% (CAS 142547-15-7) is a chemical reagent available from Chemat. Available pack sizes: 250MG. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 298392500 |
| cas | 142547-15-7 |
| size | 250MG |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 250MG | 170.61 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 99% |
Cis-ethyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride (CAS 142547-15-7) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: cis-ethyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: RYBMXCZWUCHLJB-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | cis-ethyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | RYBMXCZWUCHLJB-HHQFNNIRSA-N |
| SMILES | CCOC(=O)[C@@H]1CCC[C@@H]1N.Cl |
Computed by PubChem (NCBI)