cas: 142547-15-7 — see every product listed under this CAS number, including other names
rel-Ethyl (1R,2S)-2-aminocyclopentane-1-carboxylate hydrochloride, 97% (CAS 142547-15-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552143-100MG |
| cas | 142547-15-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 466.52 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Cis-ethyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride (CAS 142547-15-7) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: cis-ethyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride. InChIKey: RYBMXCZWUCHLJB-HHQFNNIRSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | cis-ethyl (1R,2S)-2-aminocyclopentane-1-carboxylate;hydrochloride |
| InChIKey | RYBMXCZWUCHLJB-HHQFNNIRSA-N |
| SMILES | CCOC(=O)[C@@H]1CCC[C@@H]1N.Cl |
Computed by PubChem (NCBI)