Ethyl methyl terephthalate, 97%
cas: 22163-52-6 — see every product listed under this CAS number, including other names
Ethyl methyl terephthalate, 97% (CAS 22163-52-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A899068-250mg |
| cas | 22163-52-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 793.12 Pln | |
| Ambeed | 5g | 2606.50 Pln | |
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 275.60 Pln | |
| Chemat | 1g | 520.40 Pln | |
| Chemat | 5g | 1432.40 Pln | |
| BLDpharm | 250mg | 397.66 Pln | |
| BLDpharm | 1g | 853.06 Pln | |
| BLDpharm | 5g | 2802.37 Pln | |
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 810.15 Pln | |
| Fluorochem | 5g | 2398.13 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-O-ethyl 1-O-methyl benzene-1,4-dicarboxylate (CAS 22163-52-6) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 4-O-ethyl 1-O-methyl benzene-1,4-dicarboxylate. InChIKey: SGPZSOQUJLFTMQ-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-O-ethyl 1-O-methyl benzene-1,4-dicarboxylate |
| InChIKey | SGPZSOQUJLFTMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
ethyl methyl terephthalate, Ethyl methyl p-benzenedicarboxylate, 1,4-Benzenedicarboxylic acid, 1-ethyl 4-methyl ester, 1,4-Benzenedicarboxylic acid, ethyl methyl ester, 4-O-ethyl 1-O-methyl benzene-1,4-dicarboxylate, 1,4-Benzenedicarboxylic acid 1-ethyl 4-methyl ester, Methyl ethyl terephthalate, Terephthalic acid, ethyl methyl ester, ethylmethylterephthalate, SGPZSOQUJLFTMQ-UHFFFAOYSA-N