Products 22163-52-6
CAS 22163-52-6 appears in our catalog under these names: Ethyl methyl terephthalate, 95%, 1，4–Benzenedicarboxylic acid， ethyl methyl ester, 1-ethyl 4-methyl benzene-1,4-dicarboxylate, Ethyl methyl terephthalate 97%, Ethyl methyl terephthalate, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 5g, 1000mg, 500mg, 250mg, 100mg.
4-O-ethyl 1-O-methyl benzene-1,4-dicarboxylate (CAS 22163-52-6) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 4-O-ethyl 1-O-methyl benzene-1,4-dicarboxylate. InChIKey: SGPZSOQUJLFTMQ-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | 4-O-ethyl 1-O-methyl benzene-1,4-dicarboxylate |
| InChIKey | SGPZSOQUJLFTMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
ethyl methyl terephthalate, Ethyl methyl p-benzenedicarboxylate, 1,4-Benzenedicarboxylic acid, 1-ethyl 4-methyl ester, 1,4-Benzenedicarboxylic acid, ethyl methyl ester, 4-O-ethyl 1-O-methyl benzene-1,4-dicarboxylate, 1,4-Benzenedicarboxylic acid 1-ethyl 4-methyl ester, Methyl ethyl terephthalate, Terephthalic acid, ethyl methyl ester, ethylmethylterephthalate, SGPZSOQUJLFTMQ-UHFFFAOYSA-N