Ethyl quinoline-2-carboxylate, 98%
cas: 4491-33-2 — see every product listed under this CAS number, including other names
Ethyl quinoline-2-carboxylate, 98% (CAS 4491-33-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F220466-250MG |
| cas | 4491-33-2 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 539.41 Pln | |
| Fluorochem | 10g | 778.91 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 570.62 Pln | |
| Ambeed | 10g | 915.50 Pln | |
| Ambeed | 25g | 1761.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 371.60 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 1259.60 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 214.39 Pln | |
| BLDpharm | 5g | 614.25 Pln | |
| BLDpharm | 10g | 980.79 Pln | |
| BLDpharm | 25g | 1897.13 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Ethyl quinoline-2-carboxylate (CAS 4491-33-2) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: ethyl quinoline-2-carboxylate. InChIKey: PWOYTBYNBYNZCO-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | ethyl quinoline-2-carboxylate |
| InChIKey | PWOYTBYNBYNZCO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)