cas: 4491-33-2 — see every product listed under this CAS number, including other names
Ethyl quinoline-2-carboxylate, 98% (CAS 4491-33-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F220466-250MG |
| cas | 4491-33-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 456.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl quinoline-2-carboxylate (CAS 4491-33-2) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: ethyl quinoline-2-carboxylate. InChIKey: PWOYTBYNBYNZCO-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | ethyl quinoline-2-carboxylate |
| InChIKey | PWOYTBYNBYNZCO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC2=CC=CC=C2C=C1 |
Computed by PubChem (NCBI)