CAS 2677709-81-6 appears in our catalog under these names: FGFR2-IN-2/ 98.09% (existing batch purity), FGFR2–IN–2, FGFR2-IN-2, FGFR2-IN-2, 98.25%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100 mg, 50 mg, 5 mg.
4-[3-(4-piperazin-1-ylphenyl)-1H-indazol-6-yl]phenol (CAS 2677709-81-6) is a chemical compound with the molecular formula C23H22N4O and a molecular weight of 370.4 g/mol. IUPAC name: 4-[3-(4-piperazin-1-ylphenyl)-1H-indazol-6-yl]phenol. InChIKey: OYKIIJTXTXJYKZ-UHFFFAOYSA-N.
| Molecular formula | C23H22N4O |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 4-[3-(4-piperazin-1-ylphenyl)-1H-indazol-6-yl]phenol |
| InChIKey | OYKIIJTXTXJYKZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=C(C=C2)C3=NNC4=C3C=CC(=C4)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)