cas: 174879-28-8 — see every product listed under this CAS number, including other names
FMOC-DL-2-AMINOBUTYRIC ACID, 98%, 98% (CAS 174879-28-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113123-250mg |
| cas | 174879-28-8 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 357.20 Pln | |
| Chemat | 15g | 486.80 Pln | |
| Chemat | 25g | 659.60 Pln | |
| Chemat | 100g | 1926.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid (CAS 174879-28-8) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid. InChIKey: XQIRYUNKLVPVRR-UHFFFAOYSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)butanoic acid |
| InChIKey | XQIRYUNKLVPVRR-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)