cas: 131807-57-3 — see every product listed under this CAS number, including other names
Famoxadone (CAS 131807-57-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 25g, 1x50mg, 1x100mg. Offered by: Dr. Ehrenstorfer, GLPBio, Biosynth, HPC Standards.
| brand | Dr. Ehrenstorfer |
|---|---|
| catalog number | DRE-C13399000 |
| cas | 131807-57-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Dr. Ehrenstorfer | 100mg | price on request | |
| GLPBio | 10mg | 522.15 Pln | |
| GLPBio | 100mg | 919.99 Pln | |
| GLPBio | 25mg | 611.08 Pln | |
| GLPBio | 50mg | 732.77 Pln | |
| Biosynth | 25g | price on request | |
| HPC Standards | 1x50mg | 1030.86 Pln | |
| HPC Standards | 1x100mg | 1030.86 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione (CAS 131807-57-3) is a chemical compound with the molecular formula C22H18N2O4 and a molecular weight of 374.4 g/mol. IUPAC name: 3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione. InChIKey: PCCSBWNGDMYFCW-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione |
| InChIKey | PCCSBWNGDMYFCW-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)N(C(=O)O1)NC2=CC=CC=C2)C3=CC=C(C=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)