Products 2243515-65-1
CAS 2243515-65-1 is the registry number for 2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)pyridin-4-yl)acetic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridinyl]acetic acid (CAS 2243515-65-1) is a chemical compound with the molecular formula C22H18N2O4 and a molecular weight of 374.4 g/mol. IUPAC name: 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridinyl]acetic acid. InChIKey: NXKGSQLDKWRUNS-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-pyridinyl]acetic acid |
| InChIKey | NXKGSQLDKWRUNS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=NC=CC(=C4)CC(=O)O |
Computed by PubChem (NCBI)