CAS 1071446-05-3 appears in our catalog under these names: 3-Fmoc-4-diaminobenzoic acid, 98%, Fmoc-Dbz-OH, Fmoc-Dbz-OH 95%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-aminobenzoic acid, 95%, 95%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 25g, 500mg.
4-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 1071446-05-3) is a chemical compound with the molecular formula C22H18N2O4 and a molecular weight of 374.4 g/mol. IUPAC name: 4-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: LRLZBKSOHQLVRG-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 4-amino-3-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid |
| InChIKey | LRLZBKSOHQLVRG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=C(C=CC(=C4)C(=O)O)N |
Computed by PubChem (NCBI)