CAS 132584-12-4 is the registry number for (S)-Famoxadone. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 25mg.
(S)-famoxadone is a 5-methyl-5-(4-phenoxyphenyl)-3-(phenylamino)-1,3-oxazolidine-2,4-dione that is the (active) (S)-enantiomer of famoxadone. It prevents spore germination and mycelial growth of sensitive fungi and is used in agriculture for the control of various fungal diseases. It has a role as a quinone outside inhibitor, a fungicide, an agrochemical and a mitochondrial cytochrome-bc1 complex inhibitor. It is an enantiomer of a (R)-famoxadone.
Source: ChEBI
| Molecular formula | C22H18N2O4 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | (5S)-3-anilino-5-methyl-5-(4-phenoxyphenyl)-1,3-oxazolidine-2,4-dione |
| InChIKey | PCCSBWNGDMYFCW-QFIPXVFZSA-N |
| SMILES | C[C@@]1(C(=O)N(C(=O)O1)NC2=CC=CC=C2)C3=CC=C(C=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)