Products 349615-83-4

CAS 349615-83-4 is the registry number for 2-(2-(2,2-Diphenylacetyl)hydrazine-1-carbonyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[(2,2-diphenylacetyl)amino]carbamoyl]benzoic acid (CAS 349615-83-4) is a chemical compound with the molecular formula C22H18N2O4 and a molecular weight of 374.4 g/mol. IUPAC name: 2-[[(2,2-diphenylacetyl)amino]carbamoyl]benzoic acid. InChIKey: GQHYFFHAKWRLRB-UHFFFAOYSA-N.

Identity
Molecular formulaC22H18N2O4
Molecular weight374.4 g/mol
IUPAC name2-[[(2,2-diphenylacetyl)amino]carbamoyl]benzoic acid
InChIKeyGQHYFFHAKWRLRB-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)NNC(=O)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)