cas: 29548-30-9 — see every product listed under this CAS number, including other names
Farnesyl Acetate (mixture of isomers), >95.0%(GC) (CAS 29548-30-9) is a chemical reagent available from Chemat. Available pack sizes: 5ml, 25ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | F0347-5ML |
| cas | 29548-30-9 |
| size | 5ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5ml | 128.18 Pln | |
| TCI | 25ml | 315.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
3,7,11-trimethyldodeca-2,6,10-trienyl acetate (CAS 29548-30-9) is a chemical compound with the molecular formula C17H28O2 and a molecular weight of 264.4 g/mol. IUPAC name: 3,7,11-trimethyldodeca-2,6,10-trienyl acetate. InChIKey: ZGIGZINMAOQWLX-UHFFFAOYSA-N.
| Molecular formula | C17H28O2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | 3,7,11-trimethyldodeca-2,6,10-trienyl acetate |
| InChIKey | ZGIGZINMAOQWLX-UHFFFAOYSA-N |
| SMILES | CC(=CCCC(=CCCC(=CCOC(=O)C)C)C)C |
Computed by PubChem (NCBI)