Products 40266-29-3
CAS 40266-29-3 is the registry number for (2Z,6E)-Farnesyl acetate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate (CAS 40266-29-3) is a chemical compound with the molecular formula C17H28O2 and a molecular weight of 264.4 g/mol. IUPAC name: [(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate. InChIKey: ZGIGZINMAOQWLX-HDVIWIBHSA-N.
| Molecular formula | C17H28O2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | [(2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate |
| InChIKey | ZGIGZINMAOQWLX-HDVIWIBHSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C\COC(=O)C)/C)/C)C |
Computed by PubChem (NCBI)
Synonyms:
(2Z,6E)-Farnesyl acetate, (Z,E)-farnesyl acetate, Farnesyl acetate, (2Z,6E)-, cis-2-trans-6-Farnesyl acetate, FEMA No. 4213, (2Z,6E)-, 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, 1-acetate, (2Z,6E)-, ((2Z,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl) acetate, (Z)-Farnesyl acetate, cis,trans-farnesyl acetate, cis-trans-Farnesyl acetate