CAS 696617-92-2 appears in our catalog under these names: Fluometuron-4-hydroxy, Fluometuron-4-hydroxy 100 µg/mL in Acetonitrile. Offered by: Dr. Ehrenstorfer. Available pack sizes: 10mg, 1ml.
3-[4-hydroxy-3-(trifluoromethyl)phenyl]-1,1-dimethylurea (CAS 696617-92-2) is a chemical compound with the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. IUPAC name: 3-[4-hydroxy-3-(trifluoromethyl)phenyl]-1,1-dimethylurea. InChIKey: DTGUFTPPQXTCDU-UHFFFAOYSA-N.
| Molecular formula | C10H11F3N2O2 |
|---|---|
| Molecular weight | 248.20 g/mol |
| IUPAC name | 3-[4-hydroxy-3-(trifluoromethyl)phenyl]-1,1-dimethylurea |
| InChIKey | DTGUFTPPQXTCDU-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1=CC(=C(C=C1)O)C(F)(F)F |
Computed by PubChem (NCBI)