cas: 167015-23-8 — see every product listed under this CAS number, including other names
Fmoc–Homocys(Trt)–OH (CAS 167015-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GA21699-1000 |
| cas | 167015-23-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 1008.92 Pln | |
| GLPBio | 10g | 1893.54 Pln | |
| GLPBio | 250mg | 934.04 Pln | |
| GLPBio | 5g | 1388.04 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid (CAS 167015-23-8) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid. InChIKey: FKBGJLDYRSFHBT-DHUJRADRSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid |
| InChIKey | FKBGJLDYRSFHBT-DHUJRADRSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)