cas: 167015-23-8 — see every product listed under this CAS number, including other names
Fmoc-L-HomoCys(Trt)-OH, 95% (CAS 167015-23-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F340578-250MG |
| cas | 167015-23-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 2.5g | 513.38 Pln | |
| Fluorochem | 5g | 549.82 Pln | |
| Fluorochem | 10g | 1039.24 Pln | |
| Fluorochem | 25g | 2372.10 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid (CAS 167015-23-8) is a chemical compound with the molecular formula C38H33NO4S and a molecular weight of 599.7 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid. InChIKey: FKBGJLDYRSFHBT-DHUJRADRSA-N.
| Molecular formula | C38H33NO4S |
|---|---|
| Molecular weight | 599.7 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-tritylsulfanylbutanoic acid |
| InChIKey | FKBGJLDYRSFHBT-DHUJRADRSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SCC[C@@H](C(=O)O)NC(=O)OCC4C5=CC=CC=C5C6=CC=CC=C46 |
Computed by PubChem (NCBI)