cas: 312965-07-4 — see every product listed under this CAS number, including other names
Fmoc-(1S,2S)-2-aminocyclohexane carboxylic acid, 98% (CAS 312965-07-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F493397-100MG |
| cas | 312965-07-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 539.41 Pln | |
| Fluorochem | 250mg | 997.58 Pln | |
| Fluorochem | 1g | 1903.51 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Trans-(1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 312965-07-4) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: trans-(1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: NZMNDTGOODAUNI-ICSRJNTNSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | trans-(1S,2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | NZMNDTGOODAUNI-ICSRJNTNSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)