cas: 828254-16-6 — see every product listed under this CAS number, including other names
Fmoc-(R)-3-Amino-2-benzylpropanoic acid 97% (CAS 828254-16-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A185729-100mg |
| cas | 828254-16-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 670.75 Pln | |
| Ambeed | 250mg | 1221.44 Pln | |
| Ambeed | 1g | 2795.62 Pln | |
| Ambeed | 5g | 9604.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A185729 |
(2R)-2-benzyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 828254-16-6) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: (2R)-2-benzyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: NZMKXKRMTSBQFS-GOSISDBHSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | (2R)-2-benzyl-3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | NZMKXKRMTSBQFS-GOSISDBHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)