CAS 186320-14-9 appears in our catalog under these names: Fmoc-4-(4-aminophenyl)butanoic acid, 95%, 4-(Fmoc-4-aminophenyl)butanoic acid, 4-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]benzenebutanoic acid, 98%, 98%. Offered by: Combi-blocks, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]butanoic acid (CAS 186320-14-9) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]butanoic acid. InChIKey: WDPZRHXDZBKJQJ-UHFFFAOYSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 4-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]butanoic acid |
| InChIKey | WDPZRHXDZBKJQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)CCCC(=O)O |
Computed by PubChem (NCBI)