CAS 284492-08-6 appears in our catalog under these names: N-Fmoc-dl-3-(4-methylphenyl)-3-amino-propionic acid, 95%, 3-N-Fmoc-3-(4-methylphenyl)propionic acid 98%, β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-methylbenzenepropanoic acid, 98%, 98%, Fmoc-3-amino-3-(4-methylphenyl)-propionic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g, 10g.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid (CAS 284492-08-6) is a chemical compound with the molecular formula C25H23NO4 and a molecular weight of 401.5 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid. InChIKey: QVNBKPSESKXKBL-UHFFFAOYSA-N.
| Molecular formula | C25H23NO4 |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-methylphenyl)propanoic acid |
| InChIKey | QVNBKPSESKXKBL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)