cas: 631915-50-9 — see every product listed under this CAS number, including other names
Fmoc-3-aminomethyl-phenylacetic acid 95% (CAS 631915-50-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A705016-50mg |
| cas | 631915-50-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 214.62 Pln | |
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 3212.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A705016 |
2-[3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenyl]acetic acid (CAS 631915-50-9) is a chemical compound with the molecular formula C24H21NO4 and a molecular weight of 387.4 g/mol. IUPAC name: 2-[3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenyl]acetic acid. InChIKey: YQDLUJIUWRFNCH-UHFFFAOYSA-N.
| Molecular formula | C24H21NO4 |
|---|---|
| Molecular weight | 387.4 g/mol |
| IUPAC name | 2-[3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]phenyl]acetic acid |
| InChIKey | YQDLUJIUWRFNCH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC=CC(=C4)CC(=O)O |
Computed by PubChem (NCBI)