cas: 146346-88-5 — see every product listed under this CAS number, including other names
Fmoc-Ala-OMe, 98%(LC-MS),RG, 98%(LC-MS),RG (CAS 146346-88-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DXL-1g |
| cas | 146346-88-5 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 160.40 Pln | |
| Chemat | 100g | 395.60 Pln |
| purity | 98%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (CAS 146346-88-5) is a chemical compound with the molecular formula C19H19NO4 and a molecular weight of 325.4 g/mol. IUPAC name: methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate. InChIKey: NLYFFHNUTFDXLO-LBPRGKRZSA-N.
| Molecular formula | C19H19NO4 |
|---|---|
| Molecular weight | 325.4 g/mol |
| IUPAC name | methyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| InChIKey | NLYFFHNUTFDXLO-LBPRGKRZSA-N |
| SMILES | C[C@@H](C(=O)OC)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)