cas: 193693-65-1 — see every product listed under this CAS number, including other names
Fmoc-D-β-Pro-OH, 99.6% (CAS 193693-65-1) is a chemical reagent available from Chemat. Available pack sizes: 250 mg, 100 mg, 1 g, 500 mg, 50 g, 500 g, 100 g, 25 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W111383-250 mg |
| cas | 193693-65-1 |
| size | 250 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 250 mg | 361.49 Pln | |
| MedChemExpress | 100 mg | 259.32 Pln | |
| MedChemExpress | 1 g | 598.33 Pln | |
| MedChemExpress | 500 mg | 454.37 Pln | |
| MedChemExpress | 50 g | 3524.05 Pln | |
| MedChemExpress | 500 g | 16374.00 Pln | |
| MedChemExpress | 100 g | 5539.55 Pln | |
| MedChemExpress | 25 g | 2279.46 Pln | |
| MedChemExpress | 5 g | 937.34 Pln | |
| MedChemExpress | 10 g | 1318.15 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.6% |
(3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid (CAS 193693-65-1) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid. InChIKey: GUAMYYOQAAUXLR-CYBMUJFWSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid |
| InChIKey | GUAMYYOQAAUXLR-CYBMUJFWSA-N |
| SMILES | C1CN(C[C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)