CAS 193693-65-1 appears in our catalog under these names: (3R)-Fmoc-1-pyrrolidine-3-carboxylic acid, 95%, (R)–1–(((9H–Fluoren–9–yl)methoxy)carbonyl)pyrrolidine–3–carboxylic acid, (R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)pyrrolidine-3-carboxylic acid, 95%, 95%, Fmoc-D-β-Pro-OH, 99.6%, (R)-1-(((9H-FLUOREN-9-YL)METHOXY) CARBONYL)PYRROLIDINE-3-CARBOXYLIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g, 100g, 500g.
(3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid (CAS 193693-65-1) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid. InChIKey: GUAMYYOQAAUXLR-CYBMUJFWSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | (3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-3-carboxylic acid |
| InChIKey | GUAMYYOQAAUXLR-CYBMUJFWSA-N |
| SMILES | C1CN(C[C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)