CAS 222725-35-1 appears in our catalog under these names: Fmoc-n-(allyl)-glycine, 97%, N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-allylglycine, 98%, N–(((9H–Fluoren–9–yl)methoxy)carbonyl)–N–allylglycine, Fmoc-N-Allyl-Gly-OH, N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-allylglycine. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg, 0,5g, 250 mg, 100 mg, 1 g.
2-[9H-fluoren-9-ylmethoxycarbonyl(prop-2-enyl)amino]acetic acid (CAS 222725-35-1) is a chemical compound with the molecular formula C20H19NO4 and a molecular weight of 337.4 g/mol. IUPAC name: 2-[9H-fluoren-9-ylmethoxycarbonyl(prop-2-enyl)amino]acetic acid. InChIKey: NVNQGCMKCQZFSM-UHFFFAOYSA-N.
| Molecular formula | C20H19NO4 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | 2-[9H-fluoren-9-ylmethoxycarbonyl(prop-2-enyl)amino]acetic acid |
| InChIKey | NVNQGCMKCQZFSM-UHFFFAOYSA-N |
| SMILES | C=CCN(CC(=O)O)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)