cas: 104091-09-0 — see every product listed under this CAS number, including other names
Fmoc-D-Glu-OH, 98% (CAS 104091-09-0) is a chemical reagent available from Chemat. Available pack sizes: 100g, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F824682-100G |
| cas | 104091-09-0 |
| size | 100g |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 482.14 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 126.80 Pln | |
| Chemat | 100g | 299.60 Pln | |
| Fluorochem | 25g | 242.64 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 133.30 Pln |
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid (CAS 104091-09-0) is a chemical compound with the molecular formula C20H19NO6 and a molecular weight of 369.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid. InChIKey: QEPWHIXHJNNGLU-QGZVFWFLSA-N.
| Molecular formula | C20H19NO6 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid |
| InChIKey | QEPWHIXHJNNGLU-QGZVFWFLSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)