Products 136083-74-4

CAS 136083-74-4 is the registry number for 2-{((9H-Fluoren-9-ylmethoxy)carbonyl)amino}pentanedioic acid. Offered by: Biosynth. Available pack sizes: 10g, 1g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid (CAS 136083-74-4) is a chemical compound with the molecular formula C20H19NO6 and a molecular weight of 369.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid. InChIKey: QEPWHIXHJNNGLU-UHFFFAOYSA-N.

Identity
Molecular formulaC20H19NO6
Molecular weight369.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid
InChIKeyQEPWHIXHJNNGLU-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCC(=O)O)C(=O)O

Computed by PubChem (NCBI)