CAS 136083-74-4 is the registry number for 2-{((9H-Fluoren-9-ylmethoxy)carbonyl)amino}pentanedioic acid. Offered by: Biosynth. Available pack sizes: 10g, 1g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid (CAS 136083-74-4) is a chemical compound with the molecular formula C20H19NO6 and a molecular weight of 369.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid. InChIKey: QEPWHIXHJNNGLU-UHFFFAOYSA-N.
| Molecular formula | C20H19NO6 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioic acid |
| InChIKey | QEPWHIXHJNNGLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)