cas: 198545-72-1 — see every product listed under this CAS number, including other names
Fmoc-D-Phe(3-F)-OH, 99% (CAS 198545-72-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A537387-5g |
| cas | 198545-72-1 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 10g | 248.00 Pln | |
| Ambeed | 25g | 503.88 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 10g | 264.38 Pln | |
| BLDpharm | 25g | 536.50 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluorophenyl)propanoic acid (CAS 198545-72-1) is a chemical compound with the molecular formula C24H20FNO4 and a molecular weight of 405.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluorophenyl)propanoic acid. InChIKey: DWSDVARCJDOADL-JOCHJYFZSA-N.
| Molecular formula | C24H20FNO4 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-fluorophenyl)propanoic acid |
| InChIKey | DWSDVARCJDOADL-JOCHJYFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC(=CC=C4)F)C(=O)O |
Computed by PubChem (NCBI)